CAS 2103-92-6 appears in our catalog under these names: 4-(4-Methylphenyl)-1,3-thiazole-2-thiol, 95%, 4-(p-Tolyl)thiazole-2-thiol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 10g.
4-(4-methylphenyl)-3H-1,3-thiazole-2-thione (CAS 2103-92-6) is a chemical compound with the molecular formula C10H9NS2 and a molecular weight of 207.3 g/mol. IUPAC name: 4-(4-methylphenyl)-3H-1,3-thiazole-2-thione. InChIKey: IFHSFJUUGCCKOC-UHFFFAOYSA-N.
| Molecular formula | C10H9NS2 |
|---|---|
| Molecular weight | 207.3 g/mol |
| IUPAC name | 4-(4-methylphenyl)-3H-1,3-thiazole-2-thione |
| InChIKey | IFHSFJUUGCCKOC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CSC(=S)N2 |
Computed by PubChem (NCBI)