Products 21035-85-8
CAS 21035-85-8 is the registry number for Trimethaphan (bromide). Offered by: MedChemExpress. Available pack sizes: Get quote.
3,5-dibenzyl-8-thionia-3,5-diazatricyclo[6.3.0.02,6]undecan-4-one bromide (CAS 21035-85-8) is a chemical compound with the molecular formula C22H25BrN2OS and a molecular weight of 445.4 g/mol. IUPAC name: 3,5-dibenzyl-8-thionia-3,5-diazatricyclo[6.3.0.02,6]undecan-4-one bromide. InChIKey: RLXRHLGEJDJGKC-UHFFFAOYSA-M.
| Molecular formula | C22H25BrN2OS |
|---|---|
| Molecular weight | 445.4 g/mol |
| IUPAC name | 3,5-dibenzyl-8-thionia-3,5-diazatricyclo[6.3.0.02,6]undecan-4-one bromide |
| InChIKey | RLXRHLGEJDJGKC-UHFFFAOYSA-M |
| SMILES | C1CC2C3C(C[S+]2C1)N(C(=O)N3CC4=CC=CC=C4)CC5=CC=CC=C5.[Br-] |
Computed by PubChem (NCBI)