CAS 21037-91-2 is the registry number for diphenylphosphino(trimethylsilyl)acetylene. Offered by: GLPBio. Available pack sizes: 100mg.
Diphenyl(2-trimethylsilylethynyl)phosphane (CAS 21037-91-2) is a chemical compound with the molecular formula C17H19PSi and a molecular weight of 282.39 g/mol. IUPAC name: diphenyl(2-trimethylsilylethynyl)phosphane. InChIKey: BHAZZAXAYHVZQI-UHFFFAOYSA-N.
| Molecular formula | C17H19PSi |
|---|---|
| Molecular weight | 282.39 g/mol |
| IUPAC name | diphenyl(2-trimethylsilylethynyl)phosphane |
| InChIKey | BHAZZAXAYHVZQI-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#CP(C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)