CAS 21038-66-4 appears in our catalog under these names: Pyrido(2,3-d)pyrimidine-2,4(1h,3h)-dione, Pyrido[2,3-d]pyrimidine-2,4(1h,3h)-dione, 98%, 98%, Pyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g, 25g, 100g.
1H-pyrido[2,3-d]pyrimidine-2,4-dione (CAS 21038-66-4) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: 1H-pyrido[2,3-d]pyrimidine-2,4-dione. InChIKey: JQPYINKVAWEQDQ-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 1H-pyrido[2,3-d]pyrimidine-2,4-dione |
| InChIKey | JQPYINKVAWEQDQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NC(=O)NC2=O)N=C1 |
Computed by PubChem (NCBI)