CAS 2104-00-9 appears in our catalog under these names: 4-(4-Chlorophenyl)-1,3-thiazole-2-thiol, 95%, 4-(4-Chlorophenyl)thiazole-2-thiol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
4-(4-chlorophenyl)-3H-1,3-thiazole-2-thione (CAS 2104-00-9) is a chemical compound with the molecular formula C9H6ClNS2 and a molecular weight of 227.7 g/mol. IUPAC name: 4-(4-chlorophenyl)-3H-1,3-thiazole-2-thione. InChIKey: LXFBSCKJEIVRGP-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNS2 |
|---|---|
| Molecular weight | 227.7 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-3H-1,3-thiazole-2-thione |
| InChIKey | LXFBSCKJEIVRGP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC(=S)N2)Cl |
Computed by PubChem (NCBI)