Products 2104803-57-6
CAS 2104803-57-6 is the registry number for Methyl 2-Acetyl-2-azabicyclo[2.1.1]hexane-1-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
Methyl 2-acetyl-2-azabicyclo[2.1.1]hexane-1-carboxylate (CAS 2104803-57-6) is a chemical compound with the molecular formula C9H13NO3 and a molecular weight of 183.20 g/mol. IUPAC name: methyl 2-acetyl-2-azabicyclo[2.1.1]hexane-1-carboxylate. InChIKey: DEVNDFBSOFMNSF-UHFFFAOYSA-N.
| Molecular formula | C9H13NO3 |
|---|---|
| Molecular weight | 183.20 g/mol |
| IUPAC name | methyl 2-acetyl-2-azabicyclo[2.1.1]hexane-1-carboxylate |
| InChIKey | DEVNDFBSOFMNSF-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CC2CC1(C2)C(=O)OC |
Computed by PubChem (NCBI)