CAS 2104810-16-2 appears in our catalog under these names: (–)–5–HT2C agonist–3, (-)-5-HT2C agonist-3, 98.07%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 50 mg, 100 mg, 5 mg, 10 mg, 10mM/1mL, 25 mg.
1-[(1R,2R)-2-(5-fluoro-2-methoxyphenyl)cyclopropyl]-N-[(2-methoxyphenyl)methyl]methanamine;hydrochloride (CAS 2104810-16-2) is a chemical compound with the molecular formula C19H23ClFNO2 and a molecular weight of 351.8 g/mol. IUPAC name: 1-[(1R,2R)-2-(5-fluoro-2-methoxyphenyl)cyclopropyl]-N-[(2-methoxyphenyl)methyl]methanamine;hydrochloride. InChIKey: KNTRIIJGIFKPED-KUARMEPBSA-N.
| Molecular formula | C19H23ClFNO2 |
|---|---|
| Molecular weight | 351.8 g/mol |
| IUPAC name | 1-[(1R,2R)-2-(5-fluoro-2-methoxyphenyl)cyclopropyl]-N-[(2-methoxyphenyl)methyl]methanamine;hydrochloride |
| InChIKey | KNTRIIJGIFKPED-KUARMEPBSA-N |
| SMILES | COC1=C(C=C(C=C1)F)[C@@H]2C[C@H]2CNCC3=CC=CC=C3OC.Cl |
Computed by PubChem (NCBI)