CAS 21049-36-5 is the registry number for Potassium perfluoroheptanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Potassium 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoate (CAS 21049-36-5) is a chemical compound with the molecular formula C7F13KO2 and a molecular weight of 402.15 g/mol. IUPAC name: potassium 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoate. InChIKey: HSYXZPMOVCRLEQ-UHFFFAOYSA-M.
| Molecular formula | C7F13KO2 |
|---|---|
| Molecular weight | 402.15 g/mol |
| IUPAC name | potassium 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoate |
| InChIKey | HSYXZPMOVCRLEQ-UHFFFAOYSA-M |
| SMILES | C(=O)(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)[O-].[K+] |
Computed by PubChem (NCBI)