Products 210491-38-6

CAS 210491-38-6 appears in our catalog under these names: 2,6-Bis(trifluoromethyl)-4-bromo-benzoic acid, 95%, 4-Bromo-2,6-bis(trifluoromethyl)benzoic acid, 95+%, 4-Bromo-2,6-bis(trifluoromethyl)benzoic acid, ≥96.2%, ≥96.2%, 2,6-Bis(trifluoromethyl)-4-bromo-benzoic acid, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

4-bromo-2,6-bis(trifluoromethyl)benzoic acid (CAS 210491-38-6) is a chemical compound with the molecular formula C9H3BrF6O2 and a molecular weight of 337.01 g/mol. IUPAC name: 4-bromo-2,6-bis(trifluoromethyl)benzoic acid. InChIKey: ISXFFWSLEJLRHB-UHFFFAOYSA-N.

Identity
Molecular formulaC9H3BrF6O2
Molecular weight337.01 g/mol
IUPAC name4-bromo-2,6-bis(trifluoromethyl)benzoic acid
InChIKeyISXFFWSLEJLRHB-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1C(F)(F)F)C(=O)O)C(F)(F)F)Br

Computed by PubChem (NCBI)