Products 210584-04-6

CAS 210584-04-6 is the registry number for rac-12-bis(Heptanoylthio)glycerophosphocholine. Offered by: TRC. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

2,3-bis(heptanoylsulfanyl)propyl 2-(trimethylazaniumyl)ethyl phosphate (CAS 210584-04-6) is a chemical compound with the molecular formula C22H44NO6PS2 and a molecular weight of 513.7 g/mol. IUPAC name: 2,3-bis(heptanoylsulfanyl)propyl 2-(trimethylazaniumyl)ethyl phosphate. InChIKey: LFFIJRJGKBSELO-UHFFFAOYSA-N.

Identity
Molecular formulaC22H44NO6PS2
Molecular weight513.7 g/mol
IUPAC name2,3-bis(heptanoylsulfanyl)propyl 2-(trimethylazaniumyl)ethyl phosphate
InChIKeyLFFIJRJGKBSELO-UHFFFAOYSA-N
SMILESCCCCCCC(=O)SCC(COP(=O)([O-])OCC[N+](C)(C)C)SC(=O)CCCCCC

Computed by PubChem (NCBI)