CAS 2105860-95-3 is the registry number for 4,4'-(((4-Sulfophenyl)azanediyl)bis(methylene))dibenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[[N-[(4-carboxyphenyl)methyl]-4-sulfoanilino]methyl]benzoic acid (CAS 2105860-95-3) is a chemical compound with the molecular formula C22H19NO7S and a molecular weight of 441.5 g/mol. IUPAC name: 4-[[N-[(4-carboxyphenyl)methyl]-4-sulfoanilino]methyl]benzoic acid. InChIKey: HEWXLVDOSJBJME-UHFFFAOYSA-N.
| Molecular formula | C22H19NO7S |
|---|---|
| Molecular weight | 441.5 g/mol |
| IUPAC name | 4-[[N-[(4-carboxyphenyl)methyl]-4-sulfoanilino]methyl]benzoic acid |
| InChIKey | HEWXLVDOSJBJME-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN(CC2=CC=C(C=C2)C(=O)O)C3=CC=C(C=C3)S(=O)(=O)O)C(=O)O |
Computed by PubChem (NCBI)