Products 2105905-45-9
CAS 2105905-45-9 is the registry number for Ethyl 1-(4-methoxybenzyl)-4,6-dioxo-4,5,6,7-tetrahydro-1H-pyrazolo[3,4-b]pyridine-5-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 1-[(4-methoxyphenyl)methyl]-4,6-dioxo-7H-pyrazolo[5,4-b]pyridine-5-carboxylate (CAS 2105905-45-9) is a chemical compound with the molecular formula C17H17N3O5 and a molecular weight of 343.33 g/mol. IUPAC name: ethyl 1-[(4-methoxyphenyl)methyl]-4,6-dioxo-7H-pyrazolo[5,4-b]pyridine-5-carboxylate. InChIKey: SXZHRRSCXNJSPL-UHFFFAOYSA-N.
| Molecular formula | C17H17N3O5 |
|---|---|
| Molecular weight | 343.33 g/mol |
| IUPAC name | ethyl 1-[(4-methoxyphenyl)methyl]-4,6-dioxo-7H-pyrazolo[5,4-b]pyridine-5-carboxylate |
| InChIKey | SXZHRRSCXNJSPL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1C(=O)C2=C(NC1=O)N(N=C2)CC3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)