CAS 75695-84-0 appears in our catalog under these names: Dimethyl 4-(benzo[c][1,2,5]oxadiazol-4-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate, 98%, Isradipine EP Impurity C, Isradipine Impurity 3(Isradipine EP Impurity C). Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Dimethyl 4-(2,1,3-benzoxadiazol-4-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (CAS 75695-84-0) is a chemical compound with the molecular formula C17H17N3O5 and a molecular weight of 343.33 g/mol. IUPAC name: dimethyl 4-(2,1,3-benzoxadiazol-4-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: DIOVRLZHVYPFKN-UHFFFAOYSA-N.
| Molecular formula | C17H17N3O5 |
|---|---|
| Molecular weight | 343.33 g/mol |
| IUPAC name | dimethyl 4-(2,1,3-benzoxadiazol-4-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | DIOVRLZHVYPFKN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OC)C2=CC=CC3=NON=C32)C(=O)OC |
Computed by PubChem (NCBI)