Products 2105918-34-9
CAS 2105918-34-9 is the registry number for MAO-B-IN-13. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(E)-2-(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)ethenyl]phenol (CAS 2105918-34-9) is a chemical compound with the molecular formula C18H19NO3 and a molecular weight of 297.3 g/mol. IUPAC name: 4-[(E)-2-(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)ethenyl]phenol. InChIKey: VGWOEAXBGYNGIU-QPJJXVBHSA-N.
| Molecular formula | C18H19NO3 |
|---|---|
| Molecular weight | 297.3 g/mol |
| IUPAC name | 4-[(E)-2-(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)ethenyl]phenol |
| InChIKey | VGWOEAXBGYNGIU-QPJJXVBHSA-N |
| SMILES | CC1=NC=C(C2=C1OC(OC2)(C)C)/C=C/C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)