CAS 2106-54-9 is the registry number for 3,5,6-Trichlorooctafluorohexanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
3,5,6-trichloro-2,2,3,4,4,5,6,6-octafluorohexanoic acid (CAS 2106-54-9) is a chemical compound with the molecular formula C6HCl3F8O2 and a molecular weight of 363.4 g/mol. IUPAC name: 3,5,6-trichloro-2,2,3,4,4,5,6,6-octafluorohexanoic acid. InChIKey: ANRGSWRBGXZQLY-UHFFFAOYSA-N.
| Molecular formula | C6HCl3F8O2 |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | 3,5,6-trichloro-2,2,3,4,4,5,6,6-octafluorohexanoic acid |
| InChIKey | ANRGSWRBGXZQLY-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(C(C(C(F)(F)Cl)(F)Cl)(F)F)(F)Cl)(F)F)O |
Computed by PubChem (NCBI)