Products 2106-54-9

CAS 2106-54-9 is the registry number for 3,5,6-Trichlorooctafluorohexanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

3,5,6-trichloro-2,2,3,4,4,5,6,6-octafluorohexanoic acid (CAS 2106-54-9) is a chemical compound with the molecular formula C6HCl3F8O2 and a molecular weight of 363.4 g/mol. IUPAC name: 3,5,6-trichloro-2,2,3,4,4,5,6,6-octafluorohexanoic acid. InChIKey: ANRGSWRBGXZQLY-UHFFFAOYSA-N.

Identity
Molecular formulaC6HCl3F8O2
Molecular weight363.4 g/mol
IUPAC name3,5,6-trichloro-2,2,3,4,4,5,6,6-octafluorohexanoic acid
InChIKeyANRGSWRBGXZQLY-UHFFFAOYSA-N
SMILESC(=O)(C(C(C(C(C(F)(F)Cl)(F)Cl)(F)F)(F)Cl)(F)F)O

Computed by PubChem (NCBI)