Products 21062-20-4

CAS 21062-20-4 appears in our catalog under these names: 2,2'-Oxydiacetyl chloride, 97%, 2,2'–Oxydiacetyl Chloride, Diglycolyl chloride, 2,2'-Oxydiacetyl Chloride, >97.0%(GC)(T), 2,2'-Oxydiacetyl Chloride 97%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 1g, 5g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

2-(2-chloro-2-oxoethoxy)acetyl chloride (CAS 21062-20-4) is a chemical compound with the molecular formula C4H4Cl2O3 and a molecular weight of 170.98 g/mol. IUPAC name: 2-(2-chloro-2-oxoethoxy)acetyl chloride. InChIKey: GTZXSBQCNBNWPK-UHFFFAOYSA-N.

Identity
Molecular formulaC4H4Cl2O3
Molecular weight170.98 g/mol
IUPAC name2-(2-chloro-2-oxoethoxy)acetyl chloride
InChIKeyGTZXSBQCNBNWPK-UHFFFAOYSA-N
SMILESC(C(=O)Cl)OCC(=O)Cl

Computed by PubChem (NCBI)