Products 210644-65-8

CAS 210644-65-8 is the registry number for SU-5402 Ethyl Ester. Offered by: TRC. Available pack sizes: 50mg, 5mg.

Structural formula: {0} (CAS {1})

Ethyl 3-[4-methyl-2-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrol-3-yl]propanoate (CAS 210644-65-8) is a chemical compound with the molecular formula C19H20N2O3 and a molecular weight of 324.4 g/mol. IUPAC name: ethyl 3-[4-methyl-2-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrol-3-yl]propanoate. InChIKey: MZJWAAUWSPTDQB-GDNBJRDFSA-N.

Identity
Molecular formulaC19H20N2O3
Molecular weight324.4 g/mol
IUPAC nameethyl 3-[4-methyl-2-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrol-3-yl]propanoate
InChIKeyMZJWAAUWSPTDQB-GDNBJRDFSA-N
SMILESCCOC(=O)CCC1=C(NC=C1C)/C=C\2/C3=CC=CC=C3NC2=O

Computed by PubChem (NCBI)