CAS 2106832-55-5 is the registry number for Tofacitinib Impurity 137. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4S)-1-benzyl-N,4-dimethylpiperidin-3-amine;hydrochloride (CAS 2106832-55-5) is a chemical compound with the molecular formula C14H23ClN2 and a molecular weight of 254.80 g/mol. IUPAC name: (3R,4S)-1-benzyl-N,4-dimethylpiperidin-3-amine;hydrochloride. InChIKey: FVRZQLQXDPJADE-KYSPHBLOSA-N.
| Molecular formula | C14H23ClN2 |
|---|---|
| Molecular weight | 254.80 g/mol |
| IUPAC name | (3R,4S)-1-benzyl-N,4-dimethylpiperidin-3-amine;hydrochloride |
| InChIKey | FVRZQLQXDPJADE-KYSPHBLOSA-N |
| SMILES | C[C@H]1CCN(C[C@@H]1NC)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)