CAS 2107-16-6 is the registry number for 2-Fluorobenzaldehyde Thiosemicarbazone. Offered by: TRC. Available pack sizes: 1g.
[(E)-(2-fluorophenyl)methylideneamino]thiourea (CAS 2107-16-6) is a chemical compound with the molecular formula C8H8FN3S and a molecular weight of 197.24 g/mol. IUPAC name: [(E)-(2-fluorophenyl)methylideneamino]thiourea. InChIKey: AAVLMTXPFUGOSG-VZUCSPMQSA-N.
| Molecular formula | C8H8FN3S |
|---|---|
| Molecular weight | 197.24 g/mol |
| IUPAC name | [(E)-(2-fluorophenyl)methylideneamino]thiourea |
| InChIKey | AAVLMTXPFUGOSG-VZUCSPMQSA-N |
| SMILES | C1=CC=C(C(=C1)/C=N/NC(=S)N)F |
Computed by PubChem (NCBI)