CAS 210758-43-3 is the registry number for Bis(n–propyltetramethylcyclopentadienyl)barium. Offered by: GLPBio. Available pack sizes: 1g, 5g.
Barium(2+);bis(1,2,5,5-tetramethyl-3-propylcyclopenta-1,3-diene) (CAS 210758-43-3) is a chemical compound with the molecular formula C24H38Ba and a molecular weight of 463.9 g/mol. IUPAC name: barium(2+);bis(1,2,5,5-tetramethyl-3-propylcyclopenta-1,3-diene). InChIKey: FISZVUOZXHFZDA-UHFFFAOYSA-N.
| Molecular formula | C24H38Ba |
|---|---|
| Molecular weight | 463.9 g/mol |
| IUPAC name | barium(2+);bis(1,2,5,5-tetramethyl-3-propylcyclopenta-1,3-diene) |
| InChIKey | FISZVUOZXHFZDA-UHFFFAOYSA-N |
| SMILES | CCCC1=[C-]C(C(=C1C)C)(C)C.CCCC1=[C-]C(C(=C1C)C)(C)C.[Ba+2] |
Computed by PubChem (NCBI)