Products 210765-55-2

CAS 210765-55-2 is the registry number for Naphthalen-2-ylmethyl Thiophene-2-carbimidothioate Hydrobromide. Offered by: TRC. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Naphthalen-2-ylmethyl thiophene-2-carboximidothioate;hydrobromide (CAS 210765-55-2) is a chemical compound with the molecular formula C16H14BrNS2 and a molecular weight of 364.3 g/mol. IUPAC name: naphthalen-2-ylmethyl thiophene-2-carboximidothioate;hydrobromide. InChIKey: JNXVDHUKRXSIDL-UHFFFAOYSA-N.

Identity
Molecular formulaC16H14BrNS2
Molecular weight364.3 g/mol
IUPAC namenaphthalen-2-ylmethyl thiophene-2-carboximidothioate;hydrobromide
InChIKeyJNXVDHUKRXSIDL-UHFFFAOYSA-N
SMILESC1=CC=C2C=C(C=CC2=C1)CSC(=N)C3=CC=CS3.Br

Computed by PubChem (NCBI)