CAS 210765-55-2 is the registry number for Naphthalen-2-ylmethyl Thiophene-2-carbimidothioate Hydrobromide. Offered by: TRC. Available pack sizes: 1g.
Naphthalen-2-ylmethyl thiophene-2-carboximidothioate;hydrobromide (CAS 210765-55-2) is a chemical compound with the molecular formula C16H14BrNS2 and a molecular weight of 364.3 g/mol. IUPAC name: naphthalen-2-ylmethyl thiophene-2-carboximidothioate;hydrobromide. InChIKey: JNXVDHUKRXSIDL-UHFFFAOYSA-N.
| Molecular formula | C16H14BrNS2 |
|---|---|
| Molecular weight | 364.3 g/mol |
| IUPAC name | naphthalen-2-ylmethyl thiophene-2-carboximidothioate;hydrobromide |
| InChIKey | JNXVDHUKRXSIDL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)CSC(=N)C3=CC=CS3.Br |
Computed by PubChem (NCBI)