Products 21080-53-5
CAS 21080-53-5 is the registry number for Tubercidin 5'-diphosphate. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (CAS 21080-53-5) is a chemical compound with the molecular formula C11H16N4O10P2 and a molecular weight of 426.21 g/mol. IUPAC name: [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate. InChIKey: NCKAOCPROMQFJK-KCGFPETGSA-N.
| Molecular formula | C11H16N4O10P2 |
|---|---|
| Molecular weight | 426.21 g/mol |
| IUPAC name | [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| InChIKey | NCKAOCPROMQFJK-KCGFPETGSA-N |
| SMILES | C1=CN(C2=NC=NC(=C21)N)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)OP(=O)(O)O)O)O |
Computed by PubChem (NCBI)