CAS 210821-63-9 appears in our catalog under these names: Org 12962 Hydrochloride, Org-12962 hydrochloride, Org 12962 hydrochloride, Org-12962 (hydrochloride). Offered by: TRC, TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 50mg, 5mg, 10mg, 25mg, Get quote.
1-[6-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazine;hydrochloride (CAS 210821-63-9) is a chemical compound with the molecular formula C10H12Cl2F3N3 and a molecular weight of 302.12 g/mol. IUPAC name: 1-[6-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazine;hydrochloride. InChIKey: FVDILXYXZAAJOS-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2F3N3 |
|---|---|
| Molecular weight | 302.12 g/mol |
| IUPAC name | 1-[6-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazine;hydrochloride |
| InChIKey | FVDILXYXZAAJOS-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC(=C(C=C2)C(F)(F)F)Cl.Cl |
Computed by PubChem (NCBI)