CAS 210827-33-1 is the registry number for 4-(2-Hydroxypropan-2-yl)thiophene-2-sulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2-hydroxypropan-2-yl)thiophene-2-sulfonamide (CAS 210827-33-1) is a chemical compound with the molecular formula C7H11NO3S2 and a molecular weight of 221.3 g/mol. IUPAC name: 4-(2-hydroxypropan-2-yl)thiophene-2-sulfonamide. InChIKey: SERKAZFFYZRLEK-UHFFFAOYSA-N.
| Molecular formula | C7H11NO3S2 |
|---|---|
| Molecular weight | 221.3 g/mol |
| IUPAC name | 4-(2-hydroxypropan-2-yl)thiophene-2-sulfonamide |
| InChIKey | SERKAZFFYZRLEK-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CSC(=C1)S(=O)(=O)N)O |
Computed by PubChem (NCBI)