CAS 21085-60-9 appears in our catalog under these names: Calcium mesoxalate trihydrate, 98%, Calcium mesoxalate, 98%, Calcium Mesoxalate Trihydrate, Calcium Mesoxalate Trihydrate, >98.0%(T), Calcium Mesoxalate Trihydrate. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 5g, 1g, 250mg, Get quote.
Calcium 2-oxopropanedioate (CAS 21085-60-9) is a chemical compound with the molecular formula C3CaO5 and a molecular weight of 156.11 g/mol. IUPAC name: calcium 2-oxopropanedioate. InChIKey: YYJSBERANQTJJH-UHFFFAOYSA-L.
| Molecular formula | C3CaO5 |
|---|---|
| Molecular weight | 156.11 g/mol |
| IUPAC name | calcium 2-oxopropanedioate |
| InChIKey | YYJSBERANQTJJH-UHFFFAOYSA-L |
| SMILES | C(=O)(C(=O)[O-])C(=O)[O-].[Ca+2] |
Computed by PubChem (NCBI)