CAS 2108611-59-0 is the registry number for Diethyl (2–(4–bromophenyl)–1,1–difluoro–2–hydroxyethyl)phosphonate. Offered by: GLPBio. Available pack sizes: 250mg.
1-(4-bromophenyl)-2-diethoxyphosphoryl-2,2-difluoroethanol (CAS 2108611-59-0) is a chemical compound with the molecular formula C12H16BrF2O4P and a molecular weight of 373.13 g/mol. IUPAC name: 1-(4-bromophenyl)-2-diethoxyphosphoryl-2,2-difluoroethanol. InChIKey: KXQPKEYQTSDNRZ-UHFFFAOYSA-N.
| Molecular formula | C12H16BrF2O4P |
|---|---|
| Molecular weight | 373.13 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2-diethoxyphosphoryl-2,2-difluoroethanol |
| InChIKey | KXQPKEYQTSDNRZ-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(C(C(C1=CC=C(C=C1)Br)O)(F)F)OCC |
Computed by PubChem (NCBI)