CAS 2108646-71-3 is the registry number for tert-Butyl ((1S,2R,3R,8S)-4-(aminomethyl)cuban-1-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[4-(aminomethyl)cuban-1-yl]carbamate (CAS 2108646-71-3) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: tert-butyl N-[4-(aminomethyl)cuban-1-yl]carbamate. InChIKey: XIAQUXMCNDXLHA-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | tert-butyl N-[4-(aminomethyl)cuban-1-yl]carbamate |
| InChIKey | XIAQUXMCNDXLHA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC12C3C4C1C5C2C3C45CN |
Computed by PubChem (NCBI)