Products 2108722-93-4

CAS 2108722-93-4 is the registry number for tert-Butyl (3-amino-5,6,7,8-tetrahydroquinolin-6-yl)carbamate compound with methanol (1:1), 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-(3-amino-5,6,7,8-tetrahydroquinolin-6-yl)carbamate;methanol (CAS 2108722-93-4) is a chemical compound with the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. IUPAC name: tert-butyl N-(3-amino-5,6,7,8-tetrahydroquinolin-6-yl)carbamate;methanol. InChIKey: LVJVPTJYWXOHTD-UHFFFAOYSA-N.

Identity
Molecular formulaC15H25N3O3
Molecular weight295.38 g/mol
IUPAC nametert-butyl N-(3-amino-5,6,7,8-tetrahydroquinolin-6-yl)carbamate;methanol
InChIKeyLVJVPTJYWXOHTD-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1CCC2=C(C1)C=C(C=N2)N.CO

Computed by PubChem (NCBI)