CAS 2108943-17-3 is the registry number for rel-(1R,4S)-tert-Butyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (1R,4S)-2,5-diazabicyclo[2.2.2]octane-2-carboxylate (CAS 2108943-17-3) is a chemical compound with the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. IUPAC name: tert-butyl (1R,4S)-2,5-diazabicyclo[2.2.2]octane-2-carboxylate. InChIKey: RBLOMFQUEUBEBG-DTWKUNHWSA-N.
| Molecular formula | C11H20N2O2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | tert-butyl (1R,4S)-2,5-diazabicyclo[2.2.2]octane-2-carboxylate |
| InChIKey | RBLOMFQUEUBEBG-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CC[C@@H]1CN2 |
Computed by PubChem (NCBI)