CAS 2108968-53-0 appears in our catalog under these names: ML 324 dihydrochloride, Ml 324 dihydrochloride. Offered by: GLPBio, Biosynth. Available pack sizes: 5mg, 100mg, 50mg.
N-[3-(dimethylamino)propyl]-4-(8-hydroxyquinolin-6-yl)benzamide;dihydrochloride (CAS 2108968-53-0) is a chemical compound with the molecular formula C21H25Cl2N3O2 and a molecular weight of 422.3 g/mol. IUPAC name: N-[3-(dimethylamino)propyl]-4-(8-hydroxyquinolin-6-yl)benzamide;dihydrochloride. InChIKey: YUYSXTUKBJSXCD-UHFFFAOYSA-N.
| Molecular formula | C21H25Cl2N3O2 |
|---|---|
| Molecular weight | 422.3 g/mol |
| IUPAC name | N-[3-(dimethylamino)propyl]-4-(8-hydroxyquinolin-6-yl)benzamide;dihydrochloride |
| InChIKey | YUYSXTUKBJSXCD-UHFFFAOYSA-N |
| SMILES | CN(C)CCCNC(=O)C1=CC=C(C=C1)C2=CC(=C3C(=C2)C=CC=N3)O.Cl.Cl |
Computed by PubChem (NCBI)