CAS 2109130-48-3 is the registry number for 3-(Piperazin-1-yl)-1λâ¶-thietane-1,1-dione dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-piperazin-1-ylthietane 1,1-dioxide;dihydrochloride (CAS 2109130-48-3) is a chemical compound with the molecular formula C7H16Cl2N2O2S and a molecular weight of 263.18 g/mol. IUPAC name: 3-piperazin-1-ylthietane 1,1-dioxide;dihydrochloride. InChIKey: IYSWUEUPFAPPQR-UHFFFAOYSA-N.
| Molecular formula | C7H16Cl2N2O2S |
|---|---|
| Molecular weight | 263.18 g/mol |
| IUPAC name | 3-piperazin-1-ylthietane 1,1-dioxide;dihydrochloride |
| InChIKey | IYSWUEUPFAPPQR-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2CS(=O)(=O)C2.Cl.Cl |
Computed by PubChem (NCBI)