CAS 21093-14-1 appears in our catalog under these names: Epinephrine Impurity 1 Sodium Salt, Epinephrine Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
Sodium [2-hydroxy-5-[1-hydroxy-2-(methylamino)ethyl]phenyl] sulfate (CAS 21093-14-1) is a chemical compound with the molecular formula C9H12NNaO6S and a molecular weight of 285.25 g/mol. IUPAC name: sodium [2-hydroxy-5-[1-hydroxy-2-(methylamino)ethyl]phenyl] sulfate. InChIKey: RZICJPMPFOHJMK-UHFFFAOYSA-M.
| Molecular formula | C9H12NNaO6S |
|---|---|
| Molecular weight | 285.25 g/mol |
| IUPAC name | sodium [2-hydroxy-5-[1-hydroxy-2-(methylamino)ethyl]phenyl] sulfate |
| InChIKey | RZICJPMPFOHJMK-UHFFFAOYSA-M |
| SMILES | CNCC(C1=CC(=C(C=C1)O)OS(=O)(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)