CAS 2109699-73-0 appears in our catalog under these names: Acephate-d6, >95% (GC), Acephate-d6. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 2,5mg, 1 mg.
N-[trideuteriomethoxy(trideuteriomethylsulfanyl)phosphoryl]acetamide (CAS 2109699-73-0) is a chemical compound with the molecular formula C4H10NO3PS and a molecular weight of 189.21 g/mol. IUPAC name: N-[trideuteriomethoxy(trideuteriomethylsulfanyl)phosphoryl]acetamide. InChIKey: YASYVMFAVPKPKE-XERRXZQWSA-N.
| Molecular formula | C4H10NO3PS |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | N-[trideuteriomethoxy(trideuteriomethylsulfanyl)phosphoryl]acetamide |
| InChIKey | YASYVMFAVPKPKE-XERRXZQWSA-N |
| SMILES | [2H]C([2H])([2H])OP(=O)(NC(=O)C)SC([2H])([2H])[2H] |
Computed by PubChem (NCBI)