Products 2109898-87-3
CAS 2109898-87-3 is the registry number for rel-3-((1R,3R,5S)-bicyclo[3.1.0]hexan-3-yl)propiolic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]prop-2-ynoic acid (CAS 2109898-87-3) is a chemical compound with the molecular formula C9H10O2 and a molecular weight of 150.17 g/mol. IUPAC name: 3-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]prop-2-ynoic acid. InChIKey: HXBDYJGLGZYJIU-IEESLHIDSA-N.
| Molecular formula | C9H10O2 |
|---|---|
| Molecular weight | 150.17 g/mol |
| IUPAC name | 3-[(1S,5R)-3-bicyclo[3.1.0]hexanyl]prop-2-ynoic acid |
| InChIKey | HXBDYJGLGZYJIU-IEESLHIDSA-N |
| SMILES | C1[C@H]2[C@@H]1CC(C2)C#CC(=O)O |
Computed by PubChem (NCBI)