Products 21105-70-4
CAS 21105-70-4 is the registry number for 2-[[(4S)-4-amino-5-(carboxymethylamino)-5-oxo-pentanoyl]amino]acetic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2-[[(4S)-4-amino-5-(carboxymethylamino)-5-oxopentanoyl]amino]acetic acid (CAS 21105-70-4) is a chemical compound with the molecular formula C9H15N3O6 and a molecular weight of 261.23 g/mol. IUPAC name: 2-[[(4S)-4-amino-5-(carboxymethylamino)-5-oxopentanoyl]amino]acetic acid. InChIKey: UODMQTNTCFCEFB-YFKPBYRVSA-N.
| Molecular formula | C9H15N3O6 |
|---|---|
| Molecular weight | 261.23 g/mol |
| IUPAC name | 2-[[(4S)-4-amino-5-(carboxymethylamino)-5-oxopentanoyl]amino]acetic acid |
| InChIKey | UODMQTNTCFCEFB-YFKPBYRVSA-N |
| SMILES | C(CC(=O)NCC(=O)O)[C@@H](C(=O)NCC(=O)O)N |
Computed by PubChem (NCBI)