Products 1803596-43-1

CAS 1803596-43-1 is the registry number for 1-(5-(Ethoxymethyl)-1,3,4-oxadiazol-2-yl)ethan-1-amine, oxalic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

1-[5-(ethoxymethyl)-1,3,4-oxadiazol-2-yl]ethanamine;oxalic acid (CAS 1803596-43-1) is a chemical compound with the molecular formula C9H15N3O6 and a molecular weight of 261.23 g/mol. IUPAC name: 1-[5-(ethoxymethyl)-1,3,4-oxadiazol-2-yl]ethanamine;oxalic acid. InChIKey: TYFOIZIYNOQJHN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H15N3O6
Molecular weight261.23 g/mol
IUPAC name1-[5-(ethoxymethyl)-1,3,4-oxadiazol-2-yl]ethanamine;oxalic acid
InChIKeyTYFOIZIYNOQJHN-UHFFFAOYSA-N
SMILESCCOCC1=NN=C(O1)C(C)N.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)