CAS 211058-80-9 appears in our catalog under these names: (2S,4R)-Methyl 4-hydroxypiperidine-2-carboxylate, 98%, (2S,4R)-Methyl-4-hydroxypiperidine-2-carboxylate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
Methyl (2S,4R)-4-hydroxypiperidine-2-carboxylate (CAS 211058-80-9) is a chemical compound with the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. IUPAC name: methyl (2S,4R)-4-hydroxypiperidine-2-carboxylate. InChIKey: XYDFSCGFCFYWNY-RITPCOANSA-N.
| Molecular formula | C7H13NO3 |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | methyl (2S,4R)-4-hydroxypiperidine-2-carboxylate |
| InChIKey | XYDFSCGFCFYWNY-RITPCOANSA-N |
| SMILES | COC(=O)[C@@H]1C[C@@H](CCN1)O |
Computed by PubChem (NCBI)