CAS 211105-29-2 appears in our catalog under these names: Prostaglandin D2-d4, Prostaglandin D2–d4, Prostaglandin D2-d4, 98.81%. Offered by: Chemat Brand, Hubei YoungXin, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 100μg, 25μg.
(Z)-3,3,4,4-tetradeuterio-7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]hept-5-enoic acid (CAS 211105-29-2) is a chemical compound with the molecular formula C20H32O5 and a molecular weight of 356.5 g/mol. IUPAC name: (Z)-3,3,4,4-tetradeuterio-7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]hept-5-enoic acid. InChIKey: BHMBVRSPMRCCGG-DCNIGHKFSA-N.
| Molecular formula | C20H32O5 |
|---|---|
| Molecular weight | 356.5 g/mol |
| IUPAC name | (Z)-3,3,4,4-tetradeuterio-7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]hept-5-enoic acid |
| InChIKey | BHMBVRSPMRCCGG-DCNIGHKFSA-N |
| SMILES | [2H]C([2H])(CC(=O)O)C([2H])([2H])/C=C\C[C@H]1[C@H](CC(=O)[C@@H]1/C=C/[C@H](CCCCC)O)O |
Computed by PubChem (NCBI)