Products 211105-33-8
CAS 211105-33-8 appears in our catalog under these names: Prostaglandin E1-d4, Prostaglandin E1–d4. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 25mg, 100μg, 50μg, 500μg, 1 mg, 50 μg, 10 mg.
3,3,4,4-tetradeuterio-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoic acid (CAS 211105-33-8) is a chemical compound with the molecular formula C20H34O5 and a molecular weight of 358.5 g/mol. IUPAC name: 3,3,4,4-tetradeuterio-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoic acid. InChIKey: GMVPRGQOIOIIMI-HKEIXBCBSA-N.
| Molecular formula | C20H34O5 |
|---|---|
| Molecular weight | 358.5 g/mol |
| IUPAC name | 3,3,4,4-tetradeuterio-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoic acid |
| InChIKey | GMVPRGQOIOIIMI-HKEIXBCBSA-N |
| SMILES | [2H]C([2H])(CCC[C@@H]1[C@H]([C@@H](CC1=O)O)/C=C/[C@H](CCCCC)O)C([2H])([2H])CC(=O)O |
Computed by PubChem (NCBI)