Products 211116-98-2

CAS 211116-98-2 appears in our catalog under these names: Pranlukast Chromene Carboxylic Acid Impurity, Pranlukast Impurity 1. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

4-oxo-8-[[4-(4-phenylbutoxy)benzoyl]amino]chromene-2-carboxylic acid (CAS 211116-98-2) is a chemical compound with the molecular formula C27H23NO6 and a molecular weight of 457.5 g/mol. IUPAC name: 4-oxo-8-[[4-(4-phenylbutoxy)benzoyl]amino]chromene-2-carboxylic acid. InChIKey: YQIRJBJZBAZXDP-UHFFFAOYSA-N.

Identity
Molecular formulaC27H23NO6
Molecular weight457.5 g/mol
IUPAC name4-oxo-8-[[4-(4-phenylbutoxy)benzoyl]amino]chromene-2-carboxylic acid
InChIKeyYQIRJBJZBAZXDP-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CCCCOC2=CC=C(C=C2)C(=O)NC3=CC=CC4=C3OC(=CC4=O)C(=O)O

Computed by PubChem (NCBI)