CAS 21117-79-3 appears in our catalog under these names: Bis(1,3-dioxo-1,3-dihydroisobenzofuran-5-yl) terephthalate, 98%, Bis[(3,4-dicarboxylic anhydride) phenyl]terephthalate, ≥96%, ≥96%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 250mg, 1g, 25g.
Bis(1,3-dioxo-2-benzofuran-5-yl) benzene-1,4-dicarboxylate (CAS 21117-79-3) is a chemical compound with the molecular formula C24H10O10 and a molecular weight of 458.3 g/mol. IUPAC name: bis(1,3-dioxo-2-benzofuran-5-yl) benzene-1,4-dicarboxylate. InChIKey: JMHUKWKCCHMXEL-UHFFFAOYSA-N.
| Molecular formula | C24H10O10 |
|---|---|
| Molecular weight | 458.3 g/mol |
| IUPAC name | bis(1,3-dioxo-2-benzofuran-5-yl) benzene-1,4-dicarboxylate |
| InChIKey | JMHUKWKCCHMXEL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)OC2=CC3=C(C=C2)C(=O)OC3=O)C(=O)OC4=CC5=C(C=C4)C(=O)OC5=O |
Computed by PubChem (NCBI)