CAS 211230-35-2 appears in our catalog under these names: Avanafil Impurity 8, Avanafil Impurity 30, Ethyl 4–((4–methoxybenzyl)amino)–2–(methylthio)pyrimidine–5–carboxylate, Ethyl 4-((4-methoxybenzyl)amino)-2-(methylthio)pyrimidine-5-carboxylate 95%, Ethyl 4-((4-methoxybenzyl)amino)-2-(methylthio)pyrimidine-5-carboxylate, 95%, 95%. Offered by: Chemat Brand, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 1g, 5g, 250mg.
Ethyl 4-[(4-methoxyphenyl)methylamino]-2-methylsulfanylpyrimidine-5-carboxylate (CAS 211230-35-2) is a chemical compound with the molecular formula C16H19N3O3S and a molecular weight of 333.4 g/mol. IUPAC name: ethyl 4-[(4-methoxyphenyl)methylamino]-2-methylsulfanylpyrimidine-5-carboxylate. InChIKey: NSYZKHHFIPHURY-UHFFFAOYSA-N.
| Molecular formula | C16H19N3O3S |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | ethyl 4-[(4-methoxyphenyl)methylamino]-2-methylsulfanylpyrimidine-5-carboxylate |
| InChIKey | NSYZKHHFIPHURY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(N=C1NCC2=CC=C(C=C2)OC)SC |
Computed by PubChem (NCBI)