CAS 211237-94-4 is the registry number for 6-O-Acetyl-2-azido-3,4-di-O-benzyl-2-deoxy-D-glucopyranose. Offered by: Biosynth, Chemat. Available pack sizes: 1000mg, 500mg, 100mg, 1g, 250mg, 2g, 2000mg.
[(2R,3S,4R,5R)-5-azido-6-hydroxy-3,4-bis(phenylmethoxy)oxan-2-yl]methyl acetate (CAS 211237-94-4) is a chemical compound with the molecular formula C22H25N3O6 and a molecular weight of 427.4 g/mol. IUPAC name: [(2R,3S,4R,5R)-5-azido-6-hydroxy-3,4-bis(phenylmethoxy)oxan-2-yl]methyl acetate. InChIKey: GKZFEMRXZMCDPE-HDKZTWHISA-N.
| Molecular formula | C22H25N3O6 |
|---|---|
| Molecular weight | 427.4 g/mol |
| IUPAC name | [(2R,3S,4R,5R)-5-azido-6-hydroxy-3,4-bis(phenylmethoxy)oxan-2-yl]methyl acetate |
| InChIKey | GKZFEMRXZMCDPE-HDKZTWHISA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H](C(O1)O)N=[N+]=[N-])OCC2=CC=CC=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)