CAS 21124-69-6 is the registry number for 4-methoxy-1-(2-(4-methoxyphenyl)-4,5-diphenylimidazolyl)benzene. Offered by: Biosynth. Available pack sizes: 250mg.
1,2-bis(4-methoxyphenyl)-4,5-diphenylimidazole (CAS 21124-69-6) is a chemical compound with the molecular formula C29H24N2O2 and a molecular weight of 432.5 g/mol. IUPAC name: 1,2-bis(4-methoxyphenyl)-4,5-diphenylimidazole. InChIKey: WMEHCJJSXDBOOZ-UHFFFAOYSA-N.
| Molecular formula | C29H24N2O2 |
|---|---|
| Molecular weight | 432.5 g/mol |
| IUPAC name | 1,2-bis(4-methoxyphenyl)-4,5-diphenylimidazole |
| InChIKey | WMEHCJJSXDBOOZ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NC(=C(N2C3=CC=C(C=C3)OC)C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)