CAS 2112760-93-5 is the registry number for 2-Iodo-5-(p-tolyl)furan, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.
2-iodo-5-(4-methylphenyl)furan (CAS 2112760-93-5) is a chemical compound with the molecular formula C11H9IO and a molecular weight of 284.09 g/mol. IUPAC name: 2-iodo-5-(4-methylphenyl)furan. InChIKey: OYBVRVWZXVRARN-UHFFFAOYSA-N.
| Molecular formula | C11H9IO |
|---|---|
| Molecular weight | 284.09 g/mol |
| IUPAC name | 2-iodo-5-(4-methylphenyl)furan |
| InChIKey | OYBVRVWZXVRARN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC=C(O2)I |
Computed by PubChem (NCBI)