CAS 2112847-76-2 is the registry number for (S)-2-((S)-2,6-Diaminohexanamido)-3-(4-(phosphonomethyl)phenyl)propanoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-[4-(phosphonomethyl)phenyl]propanoic acid (CAS 2112847-76-2) is a chemical compound with the molecular formula C16H26N3O6P and a molecular weight of 387.37 g/mol. IUPAC name: (2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-[4-(phosphonomethyl)phenyl]propanoic acid. InChIKey: VTNIYGWUJGYDBH-KBPBESRZSA-N.
| Molecular formula | C16H26N3O6P |
|---|---|
| Molecular weight | 387.37 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-[4-(phosphonomethyl)phenyl]propanoic acid |
| InChIKey | VTNIYGWUJGYDBH-KBPBESRZSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](C(=O)O)NC(=O)[C@H](CCCCN)N)CP(=O)(O)O |
Computed by PubChem (NCBI)