CAS 2114365-78-3 appears in our catalog under these names: Eltrombopag Impurity 34, Hetrombopag, Rafutrombopag (tautomerism), 98.33%. Offered by: Chemat Brand, GLPBio, Chemat, MedChemExpress. Available pack sizes: on request, 10mg, 5mg, 1mg, 50 mg, 5 mg, 25 mg, 100 mg.
5-[2-hydroxy-3-[[3-methyl-5-oxo-1-(5,6,7,8-tetrahydronaphthalen-2-yl)-4H-pyrazol-4-yl]diazenyl]phenyl]furan-2-carboxylic acid (CAS 2114365-78-3) is a chemical compound with the molecular formula C25H22N4O5 and a molecular weight of 458.5 g/mol. IUPAC name: 5-[2-hydroxy-3-[[3-methyl-5-oxo-1-(5,6,7,8-tetrahydronaphthalen-2-yl)-4H-pyrazol-4-yl]diazenyl]phenyl]furan-2-carboxylic acid. InChIKey: WTZFEDHEXDVDRO-UHFFFAOYSA-N.
| Molecular formula | C25H22N4O5 |
|---|---|
| Molecular weight | 458.5 g/mol |
| IUPAC name | 5-[2-hydroxy-3-[[3-methyl-5-oxo-1-(5,6,7,8-tetrahydronaphthalen-2-yl)-4H-pyrazol-4-yl]diazenyl]phenyl]furan-2-carboxylic acid |
| InChIKey | WTZFEDHEXDVDRO-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=O)C1N=NC2=CC=CC(=C2O)C3=CC=C(O3)C(=O)O)C4=CC5=C(CCCC5)C=C4 |
Computed by PubChem (NCBI)