CAS 211446-46-7 appears in our catalog under these names: Glycyl-L-Glutamine, >95% (HPLC), G-Q. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 5mg, 25mg.
(2S)-5-amino-2-[(2-aminoacetyl)amino]-5-oxopentanoic acid;hydrate (CAS 211446-46-7) is a chemical compound with the molecular formula C7H15N3O5 and a molecular weight of 221.21 g/mol. IUPAC name: (2S)-5-amino-2-[(2-aminoacetyl)amino]-5-oxopentanoic acid;hydrate. InChIKey: KLFWVRQACSYLOH-WCCKRBBISA-N.
| Molecular formula | C7H15N3O5 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | (2S)-5-amino-2-[(2-aminoacetyl)amino]-5-oxopentanoic acid;hydrate |
| InChIKey | KLFWVRQACSYLOH-WCCKRBBISA-N |
| SMILES | C(CC(=O)N)[C@@H](C(=O)O)NC(=O)CN.O |
Computed by PubChem (NCBI)