CAS 211495-72-6 is the registry number for methyl (2E)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(methoxyimino)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl (2E)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetate (CAS 211495-72-6) is a chemical compound with the molecular formula C6H8N4O3S and a molecular weight of 216.22 g/mol. IUPAC name: methyl (2E)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetate. InChIKey: YHCLNDXKKGNMBF-YCRREMRBSA-N.
| Molecular formula | C6H8N4O3S |
|---|---|
| Molecular weight | 216.22 g/mol |
| IUPAC name | methyl (2E)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetate |
| InChIKey | YHCLNDXKKGNMBF-YCRREMRBSA-N |
| SMILES | COC(=O)/C(=N/OC)/C1=NSC(=N1)N |
Computed by PubChem (NCBI)