CAS 211563-41-6 appears in our catalog under these names: Efavirenz Impurity 9, Efavirenz Impurity 17, Efavirenz Amino Alcohol Ethyl Carbamate, >95% (HPLC), EFAVIRENZ AMINO ALCOHOL ETHYL CARBAMATE. Offered by: Chemat Brand, Hubei YoungXin, TRC, Sigma-Aldrich. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Ethyl N-[4-chloro-2-[(2S)-4-cyclopropyl-1,1,1-trifluoro-2-hydroxybut-3-yn-2-yl]phenyl]carbamate (CAS 211563-41-6) is a chemical compound with the molecular formula C16H15ClF3NO3 and a molecular weight of 361.74 g/mol. IUPAC name: ethyl N-[4-chloro-2-[(2S)-4-cyclopropyl-1,1,1-trifluoro-2-hydroxybut-3-yn-2-yl]phenyl]carbamate. InChIKey: BZIKLWWRUOKZMC-HNNXBMFYSA-N.
| Molecular formula | C16H15ClF3NO3 |
|---|---|
| Molecular weight | 361.74 g/mol |
| IUPAC name | ethyl N-[4-chloro-2-[(2S)-4-cyclopropyl-1,1,1-trifluoro-2-hydroxybut-3-yn-2-yl]phenyl]carbamate |
| InChIKey | BZIKLWWRUOKZMC-HNNXBMFYSA-N |
| SMILES | CCOC(=O)NC1=C(C=C(C=C1)Cl)[C@@](C#CC2CC2)(C(F)(F)F)O |
Computed by PubChem (NCBI)